cas: 122-28-1 — see every product listed under this CAS number, including other names
N-(3-Nitrophenyl)acetamide, 98%, 98% (CAS 122-28-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JSW-10g |
| cas | 122-28-1 |
| size | 10g |
| availability | 375g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 174.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 25g | 251.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-(3-nitrophenyl)acetamide (CAS 122-28-1) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: N-(3-nitrophenyl)acetamide. InChIKey: KFTYNYHJHKCRKU-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | N-(3-nitrophenyl)acetamide |
| InChIKey | KFTYNYHJHKCRKU-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)