cas: 25233-46-9 — see every product listed under this CAS number, including other names
N-(3-methylphenyl)-3-oxobutanamide, 97% (CAS 25233-46-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F426377-100MG |
| cas | 25233-46-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 466.52 Pln | |
| Fluorochem | 250mg | 638.33 Pln | |
| Fluorochem | 1g | 1226.67 Pln | |
| Fluorochem | 5g | 4735.85 Pln | |
| Fluorochem | 10g | 9026.01 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N-(3-methylphenyl)-3-oxobutanamide (CAS 25233-46-9) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: N-(3-methylphenyl)-3-oxobutanamide. InChIKey: MFAHORNLUJVSKK-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | N-(3-methylphenyl)-3-oxobutanamide |
| InChIKey | MFAHORNLUJVSKK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC(=O)CC(=O)C |
Computed by PubChem (NCBI)