cas: 63514-63-6 — see every product listed under this CAS number, including other names
N-(4-(2-Bromopropanoyl)phenyl)acetamide, 95% (CAS 63514-63-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F547930-100MG |
| cas | 63514-63-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 732.05 Pln | |
| Fluorochem | 250mg | 1127.75 Pln | |
| Fluorochem | 1g | 1788.97 Pln | |
| Fluorochem | 5g | 5214.85 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
N-[4-(2-bromopropanoyl)phenyl]acetamide (CAS 63514-63-6) is a chemical compound with the molecular formula C11H12BrNO2 and a molecular weight of 270.12 g/mol. IUPAC name: N-[4-(2-bromopropanoyl)phenyl]acetamide. InChIKey: LLZKTKZPJBSEHD-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO2 |
|---|---|
| Molecular weight | 270.12 g/mol |
| IUPAC name | N-[4-(2-bromopropanoyl)phenyl]acetamide |
| InChIKey | LLZKTKZPJBSEHD-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)NC(=O)C)Br |
Computed by PubChem (NCBI)