cas: 22821-80-3 — see every product listed under this CAS number, including other names
N-(4-(Methylsulfonyl)phenyl)acetamide 95+% (CAS 22821-80-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A908529-5g |
| cas | 22821-80-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 748.62 Pln | |
| Ambeed | 25g | 2050.25 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A908529 |
N-(4-methylsulfonylphenyl)acetamide (CAS 22821-80-3) is a chemical compound with the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. IUPAC name: N-(4-methylsulfonylphenyl)acetamide. InChIKey: SJYUABJSWXGSAO-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3S |
|---|---|
| Molecular weight | 213.26 g/mol |
| IUPAC name | N-(4-methylsulfonylphenyl)acetamide |
| InChIKey | SJYUABJSWXGSAO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)C |
Computed by PubChem (NCBI)