cas: 22821-80-3 — see every product listed under this CAS number, including other names
N-(4-(Methylsulfonyl)phenyl)acetamide, 95%, 95% (CAS 22821-80-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114K00-50mg |
| cas | 22821-80-3 |
| size | 50mg |
| availability | 0.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 88.40 Pln | |
| Chemat | 250mg | 131.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(4-methylsulfonylphenyl)acetamide (CAS 22821-80-3) is a chemical compound with the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. IUPAC name: N-(4-methylsulfonylphenyl)acetamide. InChIKey: SJYUABJSWXGSAO-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3S |
|---|---|
| Molecular weight | 213.26 g/mol |
| IUPAC name | N-(4-methylsulfonylphenyl)acetamide |
| InChIKey | SJYUABJSWXGSAO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)C |
Computed by PubChem (NCBI)