cas: 13726-52-8 — see every product listed under this CAS number, including other names
N-(4-Aminobenzoyl)-L-glutamic acid diethyl ester (CAS 13726-52-8) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 250 mg, 1 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W141952-10 g |
| cas | 13726-52-8 |
| size | 10 g |
| availability | Get quote |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 1285.64 Pln | |
| MedChemExpress | 250 mg | 240.74 Pln | |
| MedChemExpress | 1 g | 366.13 Pln | |
| MedChemExpress | 5 g | 849.11 Pln |
| delivery time | over 3 weeks |
|---|---|
| purity | no data |
Diethyl (2S)-2-[(4-aminobenzoyl)amino]pentanedioate (CAS 13726-52-8) is a chemical compound with the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. IUPAC name: diethyl (2S)-2-[(4-aminobenzoyl)amino]pentanedioate. InChIKey: RJXFBLRRPYBPTM-ZDUSSCGKSA-N.
| Molecular formula | C16H22N2O5 |
|---|---|
| Molecular weight | 322.36 g/mol |
| IUPAC name | diethyl (2S)-2-[(4-aminobenzoyl)amino]pentanedioate |
| InChIKey | RJXFBLRRPYBPTM-ZDUSSCGKSA-N |
| SMILES | CCOC(=O)CC[C@@H](C(=O)OCC)NC(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)