cas: 1218789-92-4 — see every product listed under this CAS number, including other names
N-(4-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide 98% (CAS 1218789-92-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A669971-100mg |
| cas | 1218789-92-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 932.19 Pln | |
| Ambeed | 5g | 3079.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A669971 |
N-[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 1218789-92-4) is a chemical compound with the molecular formula C14H19BClNO3 and a molecular weight of 295.57 g/mol. IUPAC name: N-[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: APAJKMVUMKDEIC-UHFFFAOYSA-N.
| Molecular formula | C14H19BClNO3 |
|---|---|
| Molecular weight | 295.57 g/mol |
| IUPAC name | N-[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | APAJKMVUMKDEIC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)NC(=O)C)Cl |
Computed by PubChem (NCBI)