cas: 60901-27-1 — see every product listed under this CAS number, including other names
N-(4-Chlorophenyl)ethanesulfonamide, >95%, >95% (CAS 60901-27-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SCA-250mg |
| cas | 60901-27-1 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 640.40 Pln | |
| Chemat | 1g | 1840.40 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
N-(4-chlorophenyl)ethanesulfonamide (CAS 60901-27-1) is a chemical compound with the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. IUPAC name: N-(4-chlorophenyl)ethanesulfonamide. InChIKey: YCVLNLXLOPCQCX-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2S |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | N-(4-chlorophenyl)ethanesulfonamide |
| InChIKey | YCVLNLXLOPCQCX-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)NC1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)