Products 1263277-68-4
CAS 1263277-68-4 is the registry number for 3-Chloro-n,n-dimethylbenzene-1-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-N,N-dimethylbenzenesulfonamide (CAS 1263277-68-4) is a chemical compound with the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. IUPAC name: 3-chloro-N,N-dimethylbenzenesulfonamide. InChIKey: XLQKZEOINNDMTR-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2S |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | 3-chloro-N,N-dimethylbenzenesulfonamide |
| InChIKey | XLQKZEOINNDMTR-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)