CAS 7463-22-1 is the registry number for 4-Chloro-n,n-dimethyl-benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-chloro-N,N-dimethylbenzenesulfonamide (CAS 7463-22-1) is a chemical compound with the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. IUPAC name: 4-chloro-N,N-dimethylbenzenesulfonamide. InChIKey: QFNLRDMGDKMXBO-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2S |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | 4-chloro-N,N-dimethylbenzenesulfonamide |
| InChIKey | QFNLRDMGDKMXBO-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)