N-(4-Fluoro-2-methoxyphenyl)acetamide, 95%
cas: 582-11-6 — see every product listed under this CAS number, including other names
N-(4-Fluoro-2-methoxyphenyl)acetamide, 95% (CAS 582-11-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2939292-50mg |
| cas | 582-11-6 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 209.06 Pln | |
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1199.19 Pln | |
| Chemat | 50mg | 179.60 Pln | |
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 1024.40 Pln | |
| BLDpharm | 50mg | 219.95 Pln | |
| BLDpharm | 100mg | 319.91 Pln | |
| BLDpharm | 250mg | 519.84 Pln | |
| BLDpharm | 1g | 1286.24 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
N-(4-fluoro-2-methoxyphenyl)acetamide (CAS 582-11-6) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: N-(4-fluoro-2-methoxyphenyl)acetamide. InChIKey: KLFPJTDWZIYCAU-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | N-(4-fluoro-2-methoxyphenyl)acetamide |
| InChIKey | KLFPJTDWZIYCAU-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)F)OC |
Computed by PubChem (NCBI)