cas: 22459-81-0 — see every product listed under this CAS number, including other names
N-(4-bromo-3-chlorophenyl)acetamide, 95%, 95% (CAS 22459-81-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BCL7-250mg |
| cas | 22459-81-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 10g | 318.80 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 194.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(4-bromo-3-chlorophenyl)acetamide (CAS 22459-81-0) is a chemical compound with the molecular formula C8H7BrClNO and a molecular weight of 248.50 g/mol. IUPAC name: N-(4-bromo-3-chlorophenyl)acetamide. InChIKey: BVADKOYGDKTWMU-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO |
|---|---|
| Molecular weight | 248.50 g/mol |
| IUPAC name | N-(4-bromo-3-chlorophenyl)acetamide |
| InChIKey | BVADKOYGDKTWMU-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)