cas: 1343407-91-9 — see every product listed under this CAS number, including other names
N-(Allyloxycarbonyl)-L-valyl-[4-(hydroxymethyl)phenyl]-L-alaninamide 97% (CAS 1343407-91-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1211640-100mg |
| cas | 1343407-91-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln | |
| Ambeed | 25g | 6667.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1211640 |
Prop-2-enyl N-[(2S)-1-[[(2S)-1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (CAS 1343407-91-9) is a chemical compound with the molecular formula C19H27N3O5 and a molecular weight of 377.4 g/mol. IUPAC name: prop-2-enyl N-[(2S)-1-[[(2S)-1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate. InChIKey: LVLAVLCLIPDFJK-BBRMVZONSA-N.
| Molecular formula | C19H27N3O5 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | prop-2-enyl N-[(2S)-1-[[(2S)-1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| InChIKey | LVLAVLCLIPDFJK-BBRMVZONSA-N |
| SMILES | C[C@@H](C(=O)NC1=CC=C(C=C1)CO)NC(=O)[C@H](C(C)C)NC(=O)OCC=C |
Computed by PubChem (NCBI)