cas: 161290-85-3 — see every product listed under this CAS number, including other names
N-(Chloroacetyl)-4-(trifluoromethoxy)aniline, ≥97%, ≥97% (CAS 161290-85-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112SAT-1g |
| cas | 161290-85-3 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 635.60 Pln | |
| Chemat | 25g | 2426.00 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-N-[4-(trifluoromethoxy)phenyl]acetamide (CAS 161290-85-3) is a chemical compound with the molecular formula C9H7ClF3NO2 and a molecular weight of 253.60 g/mol. IUPAC name: 2-chloro-N-[4-(trifluoromethoxy)phenyl]acetamide. InChIKey: MIWYZHHKNDZBCB-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO2 |
|---|---|
| Molecular weight | 253.60 g/mol |
| IUPAC name | 2-chloro-N-[4-(trifluoromethoxy)phenyl]acetamide |
| InChIKey | MIWYZHHKNDZBCB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)CCl)OC(F)(F)F |
Computed by PubChem (NCBI)