Products 1087798-09-1
CAS 1087798-09-1 appears in our catalog under these names: 2,2,2-Trifluoroethyl n-(2-chlorophenyl)carbamate, 95%, 2,2,2-Trifluoroethyl N-(2-chlorophenyl)carbamate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2,2,2-trifluoroethyl N-(2-chlorophenyl)carbamate (CAS 1087798-09-1) is a chemical compound with the molecular formula C9H7ClF3NO2 and a molecular weight of 253.60 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(2-chlorophenyl)carbamate. InChIKey: GUFDGCRYPXVYEI-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO2 |
|---|---|
| Molecular weight | 253.60 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(2-chlorophenyl)carbamate |
| InChIKey | GUFDGCRYPXVYEI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)OCC(F)(F)F)Cl |
Computed by PubChem (NCBI)