Products 1188265-81-7
CAS 1188265-81-7 is the registry number for Ethyl 2-chloro-5-(trifluoromethyl)nicotinate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Ethyl 2-chloro-5-(trifluoromethyl)pyridine-3-carboxylate (CAS 1188265-81-7) is a chemical compound with the molecular formula C9H7ClF3NO2 and a molecular weight of 253.60 g/mol. IUPAC name: ethyl 2-chloro-5-(trifluoromethyl)pyridine-3-carboxylate. InChIKey: HXAYJDFYSKQJBU-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO2 |
|---|---|
| Molecular weight | 253.60 g/mol |
| IUPAC name | ethyl 2-chloro-5-(trifluoromethyl)pyridine-3-carboxylate |
| InChIKey | HXAYJDFYSKQJBU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=CC(=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)