cas: 20228-87-9 — see every product listed under this CAS number, including other names
N-(Cyanomethyl)-4-methylbenzenesulfonamide, 95%, 95% (CAS 20228-87-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DJNH-100mg |
| cas | 20228-87-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 582.80 Pln | |
| Chemat | 250mg | 952.40 Pln | |
| Chemat | 1g | 1744.40 Pln | |
| Chemat | 5g | 4480.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(cyanomethyl)-4-methylbenzenesulfonamide (CAS 20228-87-9) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: N-(cyanomethyl)-4-methylbenzenesulfonamide. InChIKey: KOOBRRKKRKKSMZ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | N-(cyanomethyl)-4-methylbenzenesulfonamide |
| InChIKey | KOOBRRKKRKKSMZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NCC#N |
Computed by PubChem (NCBI)