cas: 869950-48-1 — see every product listed under this CAS number, including other names
N-(Thiophen-2-ylmethyl)-2,3-dihydro-1,4-benzodioxin-6-amine 95% (CAS 869950-48-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1103071-250mg |
| cas | 869950-48-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 2311.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1103071 |
N-(thiophen-2-ylmethyl)-2,3-dihydro-1,4-benzodioxin-6-amine (CAS 869950-48-1) is a chemical compound with the molecular formula C13H13NO2S and a molecular weight of 247.31 g/mol. IUPAC name: N-(thiophen-2-ylmethyl)-2,3-dihydro-1,4-benzodioxin-6-amine. InChIKey: AWFOJZJTUDVDFF-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2S |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | N-(thiophen-2-ylmethyl)-2,3-dihydro-1,4-benzodioxin-6-amine |
| InChIKey | AWFOJZJTUDVDFF-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)NCC3=CC=CS3 |
Computed by PubChem (NCBI)