CAS 68-34-8 appears in our catalog under these names: P-Toluenesulfonanilide, 98%, p–Toluenesulfonanilide, p-Toluenesulfonanilide, >98.0%(HPLC)(T), p-Toluenesulfonanilide, p-Toluenesulfonanilide, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Chemat. Available pack sizes: 500g, 25g, 100g, 1g, 5g, 2,5g, 0,25g, 10g.
4-methyl-N-phenylbenzenesulfonamide (CAS 68-34-8) is a chemical compound with the molecular formula C13H13NO2S and a molecular weight of 247.31 g/mol. IUPAC name: 4-methyl-N-phenylbenzenesulfonamide. InChIKey: VLVCWODDMDGANW-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2S |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | 4-methyl-N-phenylbenzenesulfonamide |
| InChIKey | VLVCWODDMDGANW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)