Products 885278-51-3

CAS 885278-51-3 is the registry number for 2-(O-Tolyl)-thiazole-4-carboxylic acid ethyl ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 25g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 2-(2-methylphenyl)-1,3-thiazole-4-carboxylate (CAS 885278-51-3) is a chemical compound with the molecular formula C13H13NO2S and a molecular weight of 247.31 g/mol. IUPAC name: ethyl 2-(2-methylphenyl)-1,3-thiazole-4-carboxylate. InChIKey: FTIWJDSCQBOTIM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO2S
Molecular weight247.31 g/mol
IUPAC nameethyl 2-(2-methylphenyl)-1,3-thiazole-4-carboxylate
InChIKeyFTIWJDSCQBOTIM-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CSC(=N1)C2=CC=CC=C2C

Computed by PubChem (NCBI)