cas: 42908-33-8 — see every product listed under this CAS number, including other names
N-[(4-Methylphenyl)sulfonyl]-beta-alanine, 95%, 95% (CAS 42908-33-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D8CT-100mg |
| cas | 42908-33-8 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 554.00 Pln | |
| Chemat | 1g | 1384.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[(4-methylphenyl)sulfonylamino]propanoic acid (CAS 42908-33-8) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: 3-[(4-methylphenyl)sulfonylamino]propanoic acid. InChIKey: PPDKUGSOVUQARL-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 3-[(4-methylphenyl)sulfonylamino]propanoic acid |
| InChIKey | PPDKUGSOVUQARL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NCCC(=O)O |
Computed by PubChem (NCBI)