CAS 275808-53-2 is the registry number for 3-(Morpholin-4-ylsulfonyl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g, 250mg.
3-morpholin-4-ylsulfonylphenol (CAS 275808-53-2) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: 3-morpholin-4-ylsulfonylphenol. InChIKey: NTZRJBWFODFBRY-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 3-morpholin-4-ylsulfonylphenol |
| InChIKey | NTZRJBWFODFBRY-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC=CC(=C2)O |
Computed by PubChem (NCBI)