cas: 247170-19-0 — see every product listed under this CAS number, including other names
N-[2-chloro-4-(trifluoromethyl)phenyl]acetamide, 98%, 98% (CAS 247170-19-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113P7V-5g |
| cas | 247170-19-0 |
| size | 5g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 141.20 Pln | |
| Chemat | 25g | 261.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[2-chloro-4-(trifluoromethyl)phenyl]acetamide (CAS 247170-19-0) is a chemical compound with the molecular formula C9H7ClF3NO and a molecular weight of 237.60 g/mol. IUPAC name: N-[2-chloro-4-(trifluoromethyl)phenyl]acetamide. InChIKey: QRMZQPODCUCPQD-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO |
|---|---|
| Molecular weight | 237.60 g/mol |
| IUPAC name | N-[2-chloro-4-(trifluoromethyl)phenyl]acetamide |
| InChIKey | QRMZQPODCUCPQD-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)