cas: 238428-27-8 — see every product listed under this CAS number, including other names
N-[3-(Aminomethyl)phenyl]acetamide hydrochloride (CAS 238428-27-8) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023465-500MG |
| cas | 238428-27-8 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1414.10 Pln | |
| Fluorochem | 1g | 2221.11 Pln | |
| Fluorochem | 5g | 7307.86 Pln | |
| Fluorochem | 10g | 8172.14 Pln |
| delivery time | 3-4 weeks |
|---|
N-[3-(aminomethyl)phenyl]acetamide;hydrochloride (CAS 238428-27-8) is a chemical compound with the molecular formula C9H13ClN2O and a molecular weight of 200.66 g/mol. IUPAC name: N-[3-(aminomethyl)phenyl]acetamide;hydrochloride. InChIKey: OFLWQYJYQFAMPQ-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | N-[3-(aminomethyl)phenyl]acetamide;hydrochloride |
| InChIKey | OFLWQYJYQFAMPQ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC(=C1)CN.Cl |
Computed by PubChem (NCBI)