CAS 1502-45-0 appears in our catalog under these names: N-(2-Aminoethyl)benzamide hydrochloride, 95%, N-Benzoylethylenediamine hydrochloride, N-Benzoylethylenediamine hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 5g, 100mg, 500mg.
N-(2-aminoethyl)benzamide;hydrochloride (CAS 1502-45-0) is a chemical compound with the molecular formula C9H13ClN2O and a molecular weight of 200.66 g/mol. IUPAC name: N-(2-aminoethyl)benzamide;hydrochloride. InChIKey: BCGXHHYBXMQECD-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | N-(2-aminoethyl)benzamide;hydrochloride |
| InChIKey | BCGXHHYBXMQECD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NCCN.Cl |
Computed by PubChem (NCBI)