CAS 956977-55-2 is the registry number for 1-Butyl-5-chloro-3-methyl-1h-pyrazole-4-carbaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
1-butyl-5-chloro-3-methylpyrazole-4-carbaldehyde (CAS 956977-55-2) is a chemical compound with the molecular formula C9H13ClN2O and a molecular weight of 200.66 g/mol. IUPAC name: 1-butyl-5-chloro-3-methylpyrazole-4-carbaldehyde. InChIKey: AFKLPRXGBKYCOY-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | 1-butyl-5-chloro-3-methylpyrazole-4-carbaldehyde |
| InChIKey | AFKLPRXGBKYCOY-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=C(C(=N1)C)C=O)Cl |
Computed by PubChem (NCBI)