cas: 183742-33-8 — see every product listed under this CAS number, including other names
N-4-Boc-2-Piperazineacetic acid methyl ester, 95% (CAS 183742-33-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011519-250MG |
| cas | 183742-33-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 1018.41 Pln | |
| Fluorochem | 25g | 3319.68 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 3-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate (CAS 183742-33-8) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: tert-butyl 3-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate. InChIKey: VLMVFRLASKOYKX-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O4 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | tert-butyl 3-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate |
| InChIKey | VLMVFRLASKOYKX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(C1)CC(=O)OC |
Computed by PubChem (NCBI)