CAS 680579-19-5 appears in our catalog under these names: 2-(1-tert-Butoxycarbonylpiperazin-4-yl)propionic acid, 95%, 2-(4-(tert-Butoxycarbonyl)piperazin-1-yl)propanoic acid, 95%, 2–(4–(tert–Butoxycarbonyl)piperazin–1–yl)propanoic acid, 2-(1-tert-Butoxycarbonylpiperazin-4-yl)propionic acid, 2-(4-(tert-Butoxycarbonyl)piperazin-1-yl)propanoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 500mg, 25g.
2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]propanoic acid (CAS 680579-19-5) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]propanoic acid. InChIKey: ZCGDPFOTLCUUFB-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O4 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]propanoic acid |
| InChIKey | ZCGDPFOTLCUUFB-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N1CCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)