Products 219509-82-7

CAS 219509-82-7 is the registry number for 1-Boc-4-ethoxycarbonyl piperazine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

4-O-tert-butyl 1-O-ethyl piperazine-1,4-dicarboxylate (CAS 219509-82-7) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: 4-O-tert-butyl 1-O-ethyl piperazine-1,4-dicarboxylate. InChIKey: QKOGYJOCBHEODH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22N2O4
Molecular weight258.31 g/mol
IUPAC name4-O-tert-butyl 1-O-ethyl piperazine-1,4-dicarboxylate
InChIKeyQKOGYJOCBHEODH-UHFFFAOYSA-N
SMILESCCOC(=O)N1CCN(CC1)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)