cas: 17916-88-0 — see every product listed under this CAS number, including other names
N-Acetyl-D-valine, 98% (CAS 17916-88-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch1137UI-1g |
| cas | 17916-88-0 |
| size | 1g |
| availability | 2500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 100g | 294.80 Pln | |
| Chemat | 500g | 1243.20 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 25g | 281.04 Pln | |
| BLDpharm | 100g | 725.32 Pln | |
| BLDpharm | 500g | 2252.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-acetamido-3-methylbutanoic acid (CAS 17916-88-0) is a chemical compound with the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. IUPAC name: (2R)-2-acetamido-3-methylbutanoic acid. InChIKey: IHYJTAOFMMMOPX-ZCFIWIBFSA-N.
| Molecular formula | C7H13NO3 |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | (2R)-2-acetamido-3-methylbutanoic acid |
| InChIKey | IHYJTAOFMMMOPX-ZCFIWIBFSA-N |
| SMILES | CC(C)[C@H](C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)