cas: 2251118-07-5 — see every product listed under this CAS number, including other names
N-Allyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide 98% (CAS 2251118-07-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1379574-250mg |
| cas | 2251118-07-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 670.75 Pln | |
| Ambeed | 25g | 2111.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1379574 |
N-prop-2-enyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2251118-07-5) is a chemical compound with the molecular formula C16H22BNO3 and a molecular weight of 287.2 g/mol. IUPAC name: N-prop-2-enyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: XUXUPJSGVSOBRJ-UHFFFAOYSA-N.
| Molecular formula | C16H22BNO3 |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | N-prop-2-enyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | XUXUPJSGVSOBRJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)NCC=C |
Computed by PubChem (NCBI)