N-Aminofluorescein
cas: 98907-26-7 — see every product listed under this CAS number, including other names
N-Aminofluorescein (CAS 98907-26-7) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: TargetMol, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | T86956-2mg |
| cas | 98907-26-7 |
| size | 2mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 2mg | 386.15 Pln | |
| TargetMol | 5mg | 458.82 Pln | |
| TargetMol | 10mg | 565.03 Pln | |
| TargetMol | 25mg | 877.51 Pln | |
| TargetMol | 50mg | 1322.47 Pln | |
| TargetMol | 100mg | 1846.81 Pln | |
| Chemat | 2mg | 189.20 Pln | |
| Chemat | 5mg | 256.40 Pln | |
| Chemat | 10mg | 328.40 Pln | |
| Chemat | 25mg | 573.20 Pln | |
| Chemat | 50mg | 899.60 Pln | |
| Chemat | 100mg | 1312.40 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 19 days |
2-amino-3',6'-dihydroxyspiro[isoindole-3,9'-xanthene]-1-one (CAS 98907-26-7) is a chemical compound with the molecular formula C20H14N2O4 and a molecular weight of 346.3 g/mol. IUPAC name: 2-amino-3',6'-dihydroxyspiro[isoindole-3,9'-xanthene]-1-one. InChIKey: CHYVTSCIBXXQJT-UHFFFAOYSA-N.
| Molecular formula | C20H14N2O4 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | 2-amino-3',6'-dihydroxyspiro[isoindole-3,9'-xanthene]-1-one |
| InChIKey | CHYVTSCIBXXQJT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)N |
Computed by PubChem (NCBI)
Synonyms:
N-Aminofluorescein, 2-amino-3',6'-dihydroxyspiro[isoindoline-1,9'-xanthen]-3-one, 2-amino-3',6'-dihydroxyspiro[isoindole-3,9'-xanthene]-1-one, 2-amino-3',6'-dihydroxyspiro[isoindole-1,9'-xanthen]-3(2H)-one, 2-Amino-3',6'-dihydroxyspiro[1H-isoindole-1,9'-[9H]xanthen]-3(2H)-one, orb2565728, orb2900267, Spiro[1H-isoindole-1,9'-[9H]xanthen]-3(2H)-one, 2-amino-3',6'-dihydroxy-