Products 2754370-99-3
CAS 2754370-99-3 appears in our catalog under these names: SARS-CoV-2 Mpro-IN-9/ 99.78% (existing batch purity), SARS-CoV-2 Mpro-IN-9. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 10 mg.
5,6,7-trihydroxy-2,3-diphenylquinazolin-4-one (CAS 2754370-99-3) is a chemical compound with the molecular formula C20H14N2O4 and a molecular weight of 346.3 g/mol. IUPAC name: 5,6,7-trihydroxy-2,3-diphenylquinazolin-4-one. InChIKey: PNPMYLKONYDRLR-UHFFFAOYSA-N.
| Molecular formula | C20H14N2O4 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | 5,6,7-trihydroxy-2,3-diphenylquinazolin-4-one |
| InChIKey | PNPMYLKONYDRLR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=CC(=C(C(=C3C(=O)N2C4=CC=CC=C4)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
SARS-CoV-2 Mpro-IN-9, orb1944257