cas: 740842-73-3 — see every product listed under this CAS number, including other names
N-BOC-7-BROMO-2,3-DIHYDROBENZO[F][1,4]OXAZEPINE (CAS 740842-73-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F302902-250MG |
| cas | 740842-73-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 502.97 Pln | |
| Fluorochem | 1g | 1268.32 Pln | |
| Fluorochem | 5g | 5464.76 Pln | |
| Fluorochem | 25g | 19293.22 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl 7-bromo-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate (CAS 740842-73-3) is a chemical compound with the molecular formula C14H18BrNO3 and a molecular weight of 328.20 g/mol. IUPAC name: tert-butyl 7-bromo-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate. InChIKey: GOTCHZNAPXYRGA-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO3 |
|---|---|
| Molecular weight | 328.20 g/mol |
| IUPAC name | tert-butyl 7-bromo-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate |
| InChIKey | GOTCHZNAPXYRGA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2=C(C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)