cas: 740842-73-3 — see every product listed under this CAS number, including other names
tert-Butyl 7-bromo-2,3-dihydro-1,4-benzoxazepine-4(5H)-carboxylate, 97%, 97% (CAS 740842-73-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FG4U-100mg |
| cas | 740842-73-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 500mg | 448.40 Pln | |
| Chemat | 1g | 722.00 Pln | |
| Chemat | 5g | 3314.00 Pln | |
| Chemat | 10g | 5862.80 Pln | |
| Chemat | 25g | 11666.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 7-bromo-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate (CAS 740842-73-3) is a chemical compound with the molecular formula C14H18BrNO3 and a molecular weight of 328.20 g/mol. IUPAC name: tert-butyl 7-bromo-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate. InChIKey: GOTCHZNAPXYRGA-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO3 |
|---|---|
| Molecular weight | 328.20 g/mol |
| IUPAC name | tert-butyl 7-bromo-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate |
| InChIKey | GOTCHZNAPXYRGA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2=C(C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)