cas: 1310732-18-3 — see every product listed under this CAS number, including other names
N-BOC-AZETIDINE-3-SULFONYL CHLORIDE, 95% (CAS 1310732-18-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F803138-100MG |
| cas | 1310732-18-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 810.15 Pln | |
| Fluorochem | 250mg | 1231.88 Pln | |
| Fluorochem | 1g | 3048.94 Pln | |
| Fluorochem | 5g | 13212.03 Pln | |
| Fluorochem | 10g | 24057.17 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-chlorosulfonylazetidine-1-carboxylate (CAS 1310732-18-3) is a chemical compound with the molecular formula C8H14ClNO4S and a molecular weight of 255.72 g/mol. IUPAC name: tert-butyl 3-chlorosulfonylazetidine-1-carboxylate. InChIKey: AZNUWDVFBPYWSU-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO4S |
|---|---|
| Molecular weight | 255.72 g/mol |
| IUPAC name | tert-butyl 3-chlorosulfonylazetidine-1-carboxylate |
| InChIKey | AZNUWDVFBPYWSU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)