CAS 765962-70-7 is the registry number for Ethyl 1-(chlorosulfonyl)piperidine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.
Ethyl 1-chlorosulfonylpiperidine-3-carboxylate (CAS 765962-70-7) is a chemical compound with the molecular formula C8H14ClNO4S and a molecular weight of 255.72 g/mol. IUPAC name: ethyl 1-chlorosulfonylpiperidine-3-carboxylate. InChIKey: AYLNINMKMQOFAN-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO4S |
|---|---|
| Molecular weight | 255.72 g/mol |
| IUPAC name | ethyl 1-chlorosulfonylpiperidine-3-carboxylate |
| InChIKey | AYLNINMKMQOFAN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCCN(C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)