CAS 765962-67-2 appears in our catalog under these names: Ethyl 1-(chlorosulfonyl)piperidine-4-carboxylate, 95%, ethyl 1-(chlorosulfonyl)piperidine-4-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10g.
Ethyl 1-chlorosulfonylpiperidine-4-carboxylate (CAS 765962-67-2) is a chemical compound with the molecular formula C8H14ClNO4S and a molecular weight of 255.72 g/mol. IUPAC name: ethyl 1-chlorosulfonylpiperidine-4-carboxylate. InChIKey: RBSATNAZLGTHIX-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO4S |
|---|---|
| Molecular weight | 255.72 g/mol |
| IUPAC name | ethyl 1-chlorosulfonylpiperidine-4-carboxylate |
| InChIKey | RBSATNAZLGTHIX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(CC1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)