cas: 59279-60-6 — see every product listed under this CAS number, including other names
N-BOC-L-Glutamic acid dimethyl ester, 98%, 98% (CAS 59279-60-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11481X-1g |
| cas | 59279-60-6 |
| size | 1g |
| availability | 20000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 64.40 Pln | |
| Chemat | 5g | 69.20 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 83.60 Pln | |
| Chemat | 100g | 98.00 Pln | |
| Chemat | 250g | 146.00 Pln | |
| Chemat | 500g | 297.60 Pln | |
| Chemat | 1kg | 477.20 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Dimethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (CAS 59279-60-6) is a chemical compound with the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. IUPAC name: dimethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate. InChIKey: QNSPKWUAZQIIGZ-QMMMGPOBSA-N.
| Molecular formula | C12H21NO6 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | dimethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| InChIKey | QNSPKWUAZQIIGZ-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)