CAS 1951425-25-4 appears in our catalog under these names: (2R,6S)–4–tert–butyl 2–methyl 6–(hydroxymethyl)morpholine–2,4–dicarboxylate, (2R,6S)-4-tert-Butyl 2-methyl 6-(hydroxymethyl)morpholine-2,4-dicarboxylate 98%, (2R,6S)-4-tert-butyl 2-Methyl 6-(hydroxyMethyl)Morpholine-2,4-dicarboxylate, 98%, 98%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 50mg, 1g.
4-O-tert-butyl 2-O-methyl (2R,6S)-6-(hydroxymethyl)morpholine-2,4-dicarboxylate (CAS 1951425-25-4) is a chemical compound with the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. IUPAC name: 4-O-tert-butyl 2-O-methyl (2R,6S)-6-(hydroxymethyl)morpholine-2,4-dicarboxylate. InChIKey: QLSZIUDKMLYFGR-DTWKUNHWSA-N.
| Molecular formula | C12H21NO6 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | 4-O-tert-butyl 2-O-methyl (2R,6S)-6-(hydroxymethyl)morpholine-2,4-dicarboxylate |
| InChIKey | QLSZIUDKMLYFGR-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[C@H](C1)C(=O)OC)CO |
Computed by PubChem (NCBI)