CAS 102831-44-7 appears in our catalog under these names: Diethyl (Boc-amino)malonate, Diethyl 2–(tert–Butoxycarbonylamino)malonate, Diethyl 2-(tert-Butoxycarbonylamino)malonate 97%, DIETHYL 2-(N-(TERT-BUTOXYCARBONYL)AMINO&, Diethyl (Boc-amino)malonate, 97%, 97%. Offered by: TRC, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 500mg, 5g, 100g, 10g, 25g, 250mg, 1g, 500g.
Diethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate (CAS 102831-44-7) is a chemical compound with the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. IUPAC name: diethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate. InChIKey: ULRLHEXGRUWQLQ-UHFFFAOYSA-N.
| Molecular formula | C12H21NO6 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | diethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
| InChIKey | ULRLHEXGRUWQLQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)