N-Benzoylimidazole 95%
cas: 10364-94-0 — see every product listed under this CAS number, including other names
N-Benzoylimidazole 95% (CAS 10364-94-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A529538-250mg |
| cas | 10364-94-0 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Ambeed | 25g | 1299.31 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A529538 |
Imidazol-1-yl(phenyl)methanone (CAS 10364-94-0) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: imidazol-1-yl(phenyl)methanone. InChIKey: JEGIFBGJZPYMJS-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | imidazol-1-yl(phenyl)methanone |
| InChIKey | JEGIFBGJZPYMJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N2C=CN=C2 |
Computed by PubChem (NCBI)