CAS 39639-47-9 appears in our catalog under these names: 2-Chloro-N-(phenylmethyl)-1H-purin-6-amine, N–Benzyl–2–chloro–9H–purin–6–amine, N-Benzyl-2-chloro-9H-purin-6-amine. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 10g.
N-benzyl-2-chloro-7H-purin-6-amine (CAS 39639-47-9) is a chemical compound with the molecular formula C12H10ClN5 and a molecular weight of 259.69 g/mol. IUPAC name: N-benzyl-2-chloro-7H-purin-6-amine. InChIKey: IJKBYBPPNNHJSF-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN5 |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | N-benzyl-2-chloro-7H-purin-6-amine |
| InChIKey | IJKBYBPPNNHJSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NC(=NC3=C2NC=N3)Cl |
Computed by PubChem (NCBI)