CAS 1272840-83-1 appears in our catalog under these names: 1-((3-Chlorophenyl)methyl)-1H-pyrazolo(3,4-d)pyrimidin-4-amine, 95%, 1-((3-Chlorophenyl)methyl)-1H-pyrazolo(3,4-d)pyrimidin-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[(3-chlorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine (CAS 1272840-83-1) is a chemical compound with the molecular formula C12H10ClN5 and a molecular weight of 259.69 g/mol. IUPAC name: 1-[(3-chlorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: NZASFVZAXQNYCC-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN5 |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | 1-[(3-chlorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | NZASFVZAXQNYCC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CN2C3=NC=NC(=C3C=N2)N |
Computed by PubChem (NCBI)