Products 2118244-77-0
CAS 2118244-77-0 is the registry number for 3-(4-(4-(Aminomethyl)-1H-1,2,3-triazol-1-yl)phenyl)propiolonitrile hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[4-[4-(aminomethyl)triazol-1-yl]phenyl]prop-2-ynenitrile;hydrochloride (CAS 2118244-77-0) is a chemical compound with the molecular formula C12H10ClN5 and a molecular weight of 259.69 g/mol. IUPAC name: 3-[4-[4-(aminomethyl)triazol-1-yl]phenyl]prop-2-ynenitrile;hydrochloride. InChIKey: JZGAUVVBWJHLGN-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN5 |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | 3-[4-[4-(aminomethyl)triazol-1-yl]phenyl]prop-2-ynenitrile;hydrochloride |
| InChIKey | JZGAUVVBWJHLGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CC#N)N2C=C(N=N2)CN.Cl |
Computed by PubChem (NCBI)