cas: 179898-00-1 — see every product listed under this CAS number, including other names
N-Boc-3,4-dihydroquinoline-4(2H)-one 95% (CAS 179898-00-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A177923-100mg |
| cas | 179898-00-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1327.12 Pln | |
| Ambeed | 10g | 2267.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A177923 |
Tert-butyl 4-oxo-2,3-dihydroquinoline-1-carboxylate (CAS 179898-00-1) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: tert-butyl 4-oxo-2,3-dihydroquinoline-1-carboxylate. InChIKey: UIFOUBFGWSHWLM-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | tert-butyl 4-oxo-2,3-dihydroquinoline-1-carboxylate |
| InChIKey | UIFOUBFGWSHWLM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C2=CC=CC=C21 |
Computed by PubChem (NCBI)