cas: 939793-16-5 — see every product listed under this CAS number, including other names
N-Boc-3-Bromopyrrolidine, 95% (CAS 939793-16-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048496-250MG |
| cas | 939793-16-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 247.85 Pln | |
| Fluorochem | 10g | 331.15 Pln | |
| Fluorochem | 25g | 695.61 Pln | |
| Fluorochem | 100g | 2611.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-bromopyrrolidine-1-carboxylate (CAS 939793-16-5) is a chemical compound with the molecular formula C9H16BrNO2 and a molecular weight of 250.13 g/mol. IUPAC name: tert-butyl 3-bromopyrrolidine-1-carboxylate. InChIKey: QJTKPXFJOXKUEY-UHFFFAOYSA-N.
| Molecular formula | C9H16BrNO2 |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | tert-butyl 3-bromopyrrolidine-1-carboxylate |
| InChIKey | QJTKPXFJOXKUEY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)Br |
Computed by PubChem (NCBI)