cas: 495415-34-4 — see every product listed under this CAS number, including other names
N-Boc-4-cyanopiperidine-4-carboxylic acid, 97% (CAS 495415-34-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F050763-100MG |
| cas | 495415-34-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 903.87 Pln | |
| Fluorochem | 10g | 1601.54 Pln | |
| Fluorochem | 25g | 3142.66 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-cyano-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 495415-34-4) is a chemical compound with the molecular formula C12H18N2O4 and a molecular weight of 254.28 g/mol. IUPAC name: 4-cyano-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: URBDNSCLBSLLFQ-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O4 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 4-cyano-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | URBDNSCLBSLLFQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C#N)C(=O)O |
Computed by PubChem (NCBI)