cas: 1211594-21-6 — see every product listed under this CAS number, including other names
N-Boc-7-fluoro-3,4-dihydroquinoline-4(2H)-one, >97%, >97% (CAS 1211594-21-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114STL-100mg |
| cas | 1211594-21-6 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 722.00 Pln | |
| Chemat | 5g | 1749.20 Pln | |
| Chemat | 10g | 3165.20 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 7-fluoro-4-oxo-2,3-dihydroquinoline-1-carboxylate (CAS 1211594-21-6) is a chemical compound with the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. IUPAC name: tert-butyl 7-fluoro-4-oxo-2,3-dihydroquinoline-1-carboxylate. InChIKey: YYGPYBIGAQSMOJ-UHFFFAOYSA-N.
| Molecular formula | C14H16FNO3 |
|---|---|
| Molecular weight | 265.28 g/mol |
| IUPAC name | tert-butyl 7-fluoro-4-oxo-2,3-dihydroquinoline-1-carboxylate |
| InChIKey | YYGPYBIGAQSMOJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C2=C1C=C(C=C2)F |
Computed by PubChem (NCBI)