CAS 1260801-80-6 appears in our catalog under these names: tert-Butyl 6-fluoro-3-(hydroxymethyl)-1h-indole-1-carboxylate, 95%, tert–Butyl 6–fluoro–3–(hydroxymethyl)–1H–indole–1–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl 6-fluoro-3-(hydroxymethyl)indole-1-carboxylate (CAS 1260801-80-6) is a chemical compound with the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. IUPAC name: tert-butyl 6-fluoro-3-(hydroxymethyl)indole-1-carboxylate. InChIKey: FZLAJUBVHDBNMS-UHFFFAOYSA-N.
| Molecular formula | C14H16FNO3 |
|---|---|
| Molecular weight | 265.28 g/mol |
| IUPAC name | tert-butyl 6-fluoro-3-(hydroxymethyl)indole-1-carboxylate |
| InChIKey | FZLAJUBVHDBNMS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=C(C=C2)F)CO |
Computed by PubChem (NCBI)